JFIF ( %!1!%)+...383-7(-.+  -% &5/------------------------------------------------";!1AQ"aq2#3BRrb*!1"AQa2q#B ?yRd&vGlJwZvK)YrxB#j]ZAT^dpt{[wkWSԋ*QayBbm*&0<|0pfŷM`̬ ^.qR𽬷^EYTFíw<-.j)M-/s yqT'&FKz-([lև<G$wm2*e Z(Y-FVen櫧lҠDwүH4FX1 VsIOqSBۡNzJKzJξcX%vZcFSuMٖ%B ִ##\[%yYꉅ !VĂ1َRI-NsZJLTAPמQ:y״g_g= m֯Ye+Hyje!EcݸࢮSo{׬*h g<@KI$W+W'_> lUs1,o*ʺE.U"N&CTu7_0VyH,q ,)H㲣5<t ;rhnz%ݓz+4 i۸)P6+F>0Tв`&i}Shn?ik܀՟ȧ@mUSLFηh_er i_qt]MYhq 9LaJpPןߘvꀡ\"z[VƬ¤*aZMo=WkpSp \QhMb˒YH=ܒ m`CJt 8oFp]>pP1F>n8(*aڈ.Y݉[iTع JM!x]ԶaJSWҼܩ`yQ`*kE#nNkZKwA_7~ ΁JЍ;-2qRxYk=Uր>Z qThv@.w c{#&@#l;D$kGGvz/7[P+i3nIl`nrbmQi%}rAVPT*SF`{'6RX46PԮp(3W҅U\a*77lq^rT$vs2MU %*ŧ+\uQXVH !4t*Hg"Z챮 JX+RVU+ތ]PiJT XI= iPO=Ia3[ uؙ&2Z@.*SZ (")s8Y/-Fh Oc=@HRlPYp!wr?-dugNLpB1yWHyoP\ѕрiHִ,ِ0aUL.Yy`LSۜ,HZz!JQiVMb{( tژ <)^Qi_`: }8ٱ9_.)a[kSr> ;wWU#M^#ivT܎liH1Qm`cU+!2ɒIX%ֳNړ;ZI$?b$(9f2ZKe㼭qU8I[ U)9!mh1^N0 f_;׆2HFF'4b! yBGH_jтp'?uibQ T#ѬSX5gޒSF64ScjwU`xI]sAM( 5ATH_+s 0^IB++h@_Yjsp0{U@G -:*} TނMH*֔2Q:o@ w5(߰ua+a ~w[3W(дPYrF1E)3XTmIFqT~z*Is*清Wɴa0Qj%{T.ޅ״cz6u6݁h;֦ 8d97ݴ+ޕxзsȁ&LIJT)R0}f }PJdp`_p)əg(ŕtZ 'ϸqU74iZ{=Mhd$L|*UUn &ͶpHYJۋj /@9X?NlܾHYxnuXږAƞ8j ໲݀pQ4;*3iMlZ6w ȵP Shr!ݔDT7/ҡϲigD>jKAX3jv+ ߧز #_=zTm¦>}Tց<|ag{E*ֳ%5zW.Hh~a%j"e4i=vױi8RzM75i֟fEu64\էeo00d H韧rȪz2eulH$tQ>eO$@B /?=#٤ǕPS/·.iP28s4vOuz3zT& >Z2[0+[#Fޑ]!((!>s`rje('|,),y@\pЖE??u˹yWV%8mJ iw:u=-2dTSuGL+m<*צ1as&5su\phƃ qYLֳ>Y(PKi;Uڕp ..!i,54$IUEGLXrUE6m UJC?%4AT]I]F>׹P9+ee"Aid!Wk|tDv/ODc/,o]i"HIHQ_n spv"b}}&I:pȟU-_)Ux$l:fژɕ(I,oxin8*G>ÌKG}Rڀ8Frajٷh !*za]lx%EVRGYZoWѮ昀BXr{[d,t Eq ]lj+ N})0B,e iqT{z+O B2eB89Cڃ9YkZySi@/(W)d^Ufji0cH!hm-wB7C۔֛X$Zo)EF3VZqm)!wUxM49< 3Y .qDfzm |&T"} {*ih&266U9* <_# 7Meiu^h--ZtLSb)DVZH*#5UiVP+aSRIª!p挤c5g#zt@ypH={ {#0d N)qWT kA<Ÿ)/RT8D14y b2^OW,&Bcc[iViVdִCJ'hRh( 1K4#V`pِTw<1{)XPr9Rc 4)Srgto\Yτ~ xd"jO:A!7􋈒+E0%{M'T^`r=E*L7Q]A{]A<5ˋ.}<9_K (QL9FЍsĮC9!rpi T0q!H \@ܩB>F6 4ۺ6΋04ϲ^#>/@tyB]*ĸp6&<џDP9ᗟatM'> b쪗wI!܁V^tN!6=FD܆9*? q6h8  {%WoHoN.l^}"1+uJ ;r& / IɓKH*ǹP-J3+9 25w5IdcWg0n}U@2 #0iv腳z/^ƃOR}IvV2j(tB1){S"B\ ih.IXbƶ:GnI F.^a?>~!k''T[ע93fHlNDH;;sg-@, JOs~Ss^H '"#t=^@'W~Ap'oTڭ{Fن̴1#'c>꜡?F颅B L,2~ת-s2`aHQm:F^j&~*Nūv+{sk$F~ؒ'#kNsٗ D9PqhhkctԷFIo4M=SgIu`F=#}Zi'cu!}+CZI7NuŤIe1XT xC۷hcc7 l?ziY䠩7:E>k0Vxypm?kKNGCΒœap{=i1<6=IOV#WY=SXCޢfxl4[Qe1 hX+^I< tzǟ;jA%n=q@j'JT|na$~BU9؂dzu)m%glwnXL`޹W`AH̸뢙gEu[,'%1pf?tJ Ζmc[\ZyJvn$Hl'<+5[b]v efsЁ ^. &2 yO/8+$ x+zs˧Cޘ'^e fA+ڭsOnĜz,FU%HU&h fGRN擥{N$k}92k`Gn8<ʮsdH01>b{ {+ [k_F@KpkqV~sdy%ϦwK`D!N}N#)x9nw@7y4*\ Η$sR\xts30`O<0m~%U˓5_m ôªs::kB֫.tpv쌷\R)3Vq>ٝj'r-(du @9s5`;iaqoErY${i .Z(Џs^!yCϾ˓JoKbQU{௫e.-r|XWլYkZe0AGluIɦvd7 q -jEfۭt4q +]td_+%A"zM2xlqnVdfU^QaDI?+Vi\ϙLG9r>Y {eHUqp )=sYkt,s1!r,l鄛u#I$-֐2A=A\J]&gXƛ<ns_Q(8˗#)4qY~$'3"'UYcIv s.KO!{, ($LI rDuL_߰ Ci't{2L;\ߵ7@HK.Z)4
Devil Killer Is Here MiNi Shell

MiNi SheLL

Current Path : /home/vmanager/www/vm_observer/node_modules/puppeteer/lib/esm/puppeteer/common/

Linux 9dbcd5f6333d 5.15.0-124-generic #134-Ubuntu SMP Fri Sep 27 20:20:17 UTC 2024 x86_64
Upload File :
Current File : /home/vmanager/www/vm_observer/node_modules/puppeteer/lib/esm/puppeteer/common/Page.js

/**
 * Copyright 2017 Google Inc. All rights reserved.
 *
 * Licensed under the Apache License, Version 2.0 (the "License");
 * you may not use this file except in compliance with the License.
 * You may obtain a copy of the License at
 *
 *     http://www.apache.org/licenses/LICENSE-2.0
 *
 * Unless required by applicable law or agreed to in writing, software
 * distributed under the License is distributed on an "AS IS" BASIS,
 * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
 * See the License for the specific language governing permissions and
 * limitations under the License.
 */
import { EventEmitter } from './EventEmitter.js';
import { Connection, CDPSessionEmittedEvents, } from './Connection.js';
import { Dialog } from './Dialog.js';
import { EmulationManager } from './EmulationManager.js';
import { FrameManager, FrameManagerEmittedEvents, } from './FrameManager.js';
import { Keyboard, Mouse, Touchscreen } from './Input.js';
import { Tracing } from './Tracing.js';
import { assert, assertNever } from './assert.js';
import { helper, debugError } from './helper.js';
import { Coverage } from './Coverage.js';
import { WebWorker } from './WebWorker.js';
import { createJSHandle } from './JSHandle.js';
import { NetworkManagerEmittedEvents, } from './NetworkManager.js';
import { Accessibility } from './Accessibility.js';
import { TimeoutSettings } from './TimeoutSettings.js';
import { FileChooser } from './FileChooser.js';
import { ConsoleMessage } from './ConsoleMessage.js';
import { paperFormats } from './PDFOptions.js';
import { isNode } from '../environment.js';
/**
 * Page provides methods to interact with a single tab or
 * {@link https://developer.chrome.com/extensions/background_pages | extension background page} in Chromium.
 *
 * @remarks
 *
 * One Browser instance might have multiple Page instances.
 *
 * @example
 * This example creates a page, navigates it to a URL, and then * saves a screenshot:
 * ```js
 * const puppeteer = require('puppeteer');
 *
 * (async () => {
 *   const browser = await puppeteer.launch();
 *   const page = await browser.newPage();
 *   await page.goto('https://example.com');
 *   await page.screenshot({path: 'screenshot.png'});
 *   await browser.close();
 * })();
 * ```
 *
 * The Page class extends from Puppeteer's {@link EventEmitter} class and will
 * emit various events which are documented in the {@link PageEmittedEvents} enum.
 *
 * @example
 * This example logs a message for a single page `load` event:
 * ```js
 * page.once('load', () => console.log('Page loaded!'));
 * ```
 *
 * To unsubscribe from events use the `off` method:
 *
 * ```js
 * function logRequest(interceptedRequest) {
 *   console.log('A request was made:', interceptedRequest.url());
 * }
 * page.on('request', logRequest);
 * // Sometime later...
 * page.off('request', logRequest);
 * ```
 * @public
 */
export class Page extends EventEmitter {
    /**
     * @internal
     */
    constructor(client, target, ignoreHTTPSErrors, screenshotTaskQueue) {
        super();
        this._closed = false;
        this._timeoutSettings = new TimeoutSettings();
        this._pageBindings = new Map();
        this._javascriptEnabled = true;
        this._workers = new Map();
        // TODO: improve this typedef - it's a function that takes a file chooser or
        // something?
        this._fileChooserInterceptors = new Set();
        this._userDragInterceptionEnabled = false;
        this._handlerMap = new WeakMap();
        this._client = client;
        this._target = target;
        this._keyboard = new Keyboard(client);
        this._mouse = new Mouse(client, this._keyboard);
        this._touchscreen = new Touchscreen(client, this._keyboard);
        this._accessibility = new Accessibility(client);
        this._frameManager = new FrameManager(client, this, ignoreHTTPSErrors, this._timeoutSettings);
        this._emulationManager = new EmulationManager(client);
        this._tracing = new Tracing(client);
        this._coverage = new Coverage(client);
        this._screenshotTaskQueue = screenshotTaskQueue;
        this._viewport = null;
        client.on('Target.attachedToTarget', (event) => {
            if (event.targetInfo.type !== 'worker' &&
                event.targetInfo.type !== 'iframe') {
                // If we don't detach from service workers, they will never die.
                // We still want to attach to workers for emitting events.
                // We still want to attach to iframes so sessions may interact with them.
                // We detach from all other types out of an abundance of caution.
                // See https://source.chromium.org/chromium/chromium/src/+/main:content/browser/devtools/devtools_agent_host_impl.cc?ss=chromium&q=f:devtools%20-f:out%20%22::kTypePage%5B%5D%22
                // for the complete list of available types.
                client
                    .send('Target.detachFromTarget', {
                    sessionId: event.sessionId,
                })
                    .catch(debugError);
                return;
            }
            if (event.targetInfo.type === 'worker') {
                const session = Connection.fromSession(client).session(event.sessionId);
                const worker = new WebWorker(session, event.targetInfo.url, this._addConsoleMessage.bind(this), this._handleException.bind(this));
                this._workers.set(event.sessionId, worker);
                this.emit("workercreated" /* WorkerCreated */, worker);
            }
        });
        client.on('Target.detachedFromTarget', (event) => {
            const worker = this._workers.get(event.sessionId);
            if (!worker)
                return;
            this._workers.delete(event.sessionId);
            this.emit("workerdestroyed" /* WorkerDestroyed */, worker);
        });
        this._frameManager.on(FrameManagerEmittedEvents.FrameAttached, (event) => this.emit("frameattached" /* FrameAttached */, event));
        this._frameManager.on(FrameManagerEmittedEvents.FrameDetached, (event) => this.emit("framedetached" /* FrameDetached */, event));
        this._frameManager.on(FrameManagerEmittedEvents.FrameNavigated, (event) => this.emit("framenavigated" /* FrameNavigated */, event));
        const networkManager = this._frameManager.networkManager();
        networkManager.on(NetworkManagerEmittedEvents.Request, (event) => this.emit("request" /* Request */, event));
        networkManager.on(NetworkManagerEmittedEvents.RequestServedFromCache, (event) => this.emit("requestservedfromcache" /* RequestServedFromCache */, event));
        networkManager.on(NetworkManagerEmittedEvents.Response, (event) => this.emit("response" /* Response */, event));
        networkManager.on(NetworkManagerEmittedEvents.RequestFailed, (event) => this.emit("requestfailed" /* RequestFailed */, event));
        networkManager.on(NetworkManagerEmittedEvents.RequestFinished, (event) => this.emit("requestfinished" /* RequestFinished */, event));
        this._fileChooserInterceptors = new Set();
        client.on('Page.domContentEventFired', () => this.emit("domcontentloaded" /* DOMContentLoaded */));
        client.on('Page.loadEventFired', () => this.emit("load" /* Load */));
        client.on('Runtime.consoleAPICalled', (event) => this._onConsoleAPI(event));
        client.on('Runtime.bindingCalled', (event) => this._onBindingCalled(event));
        client.on('Page.javascriptDialogOpening', (event) => this._onDialog(event));
        client.on('Runtime.exceptionThrown', (exception) => this._handleException(exception.exceptionDetails));
        client.on('Inspector.targetCrashed', () => this._onTargetCrashed());
        client.on('Performance.metrics', (event) => this._emitMetrics(event));
        client.on('Log.entryAdded', (event) => this._onLogEntryAdded(event));
        client.on('Page.fileChooserOpened', (event) => this._onFileChooser(event));
        this._target._isClosedPromise.then(() => {
            this.emit("close" /* Close */);
            this._closed = true;
        });
    }
    /**
     * @internal
     */
    static async create(client, target, ignoreHTTPSErrors, defaultViewport, screenshotTaskQueue) {
        const page = new Page(client, target, ignoreHTTPSErrors, screenshotTaskQueue);
        await page._initialize();
        if (defaultViewport)
            await page.setViewport(defaultViewport);
        return page;
    }
    async _initialize() {
        await Promise.all([
            this._frameManager.initialize(),
            this._client.send('Target.setAutoAttach', {
                autoAttach: true,
                waitForDebuggerOnStart: false,
                flatten: true,
            }),
            this._client.send('Performance.enable'),
            this._client.send('Log.enable'),
        ]);
    }
    async _onFileChooser(event) {
        if (!this._fileChooserInterceptors.size)
            return;
        const frame = this._frameManager.frame(event.frameId);
        const context = await frame.executionContext();
        const element = await context._adoptBackendNodeId(event.backendNodeId);
        const interceptors = Array.from(this._fileChooserInterceptors);
        this._fileChooserInterceptors.clear();
        const fileChooser = new FileChooser(element, event);
        for (const interceptor of interceptors)
            interceptor.call(null, fileChooser);
    }
    /**
     * @returns `true` if drag events are being intercepted, `false` otherwise.
     */
    isDragInterceptionEnabled() {
        return this._userDragInterceptionEnabled;
    }
    /**
     * @returns `true` if the page has JavaScript enabled, `false` otherwise.
     */
    isJavaScriptEnabled() {
        return this._javascriptEnabled;
    }
    /**
     * Listen to page events.
     */
    // Note: this method exists to define event typings and handle
    // proper wireup of cooperative request interception. Actual event listening and
    // dispatching is delegated to EventEmitter.
    on(eventName, handler) {
        if (eventName === 'request') {
            const wrap = (event) => {
                event.enqueueInterceptAction(() => handler(event));
            };
            this._handlerMap.set(handler, wrap);
            return super.on(eventName, wrap);
        }
        return super.on(eventName, handler);
    }
    once(eventName, handler) {
        // Note: this method only exists to define the types; we delegate the impl
        // to EventEmitter.
        return super.once(eventName, handler);
    }
    off(eventName, handler) {
        if (eventName === 'request') {
            handler = this._handlerMap.get(handler) || handler;
        }
        return super.off(eventName, handler);
    }
    /**
     * This method is typically coupled with an action that triggers file
     * choosing. The following example clicks a button that issues a file chooser
     * and then responds with `/tmp/myfile.pdf` as if a user has selected this file.
     *
     * ```js
     * const [fileChooser] = await Promise.all([
     * page.waitForFileChooser(),
     * page.click('#upload-file-button'),
     * // some button that triggers file selection
     * ]);
     * await fileChooser.accept(['/tmp/myfile.pdf']);
     * ```
     *
     * NOTE: This must be called before the file chooser is launched. It will not
     * return a currently active file chooser.
     * @param options - Optional waiting parameters
     * @returns Resolves after a page requests a file picker.
     * @remarks
     * NOTE: In non-headless Chromium, this method results in the native file picker
     * dialog `not showing up` for the user.
     */
    async waitForFileChooser(options = {}) {
        if (!this._fileChooserInterceptors.size)
            await this._client.send('Page.setInterceptFileChooserDialog', {
                enabled: true,
            });
        const { timeout = this._timeoutSettings.timeout() } = options;
        let callback;
        const promise = new Promise((x) => (callback = x));
        this._fileChooserInterceptors.add(callback);
        return helper
            .waitWithTimeout(promise, 'waiting for file chooser', timeout)
            .catch((error) => {
            this._fileChooserInterceptors.delete(callback);
            throw error;
        });
    }
    /**
     * Sets the page's geolocation.
     * @remarks
     * NOTE: Consider using {@link BrowserContext.overridePermissions} to grant
     * permissions for the page to read its geolocation.
     * @example
     * ```js
     * await page.setGeolocation({latitude: 59.95, longitude: 30.31667});
     * ```
     */
    async setGeolocation(options) {
        const { longitude, latitude, accuracy = 0 } = options;
        if (longitude < -180 || longitude > 180)
            throw new Error(`Invalid longitude "${longitude}": precondition -180 <= LONGITUDE <= 180 failed.`);
        if (latitude < -90 || latitude > 90)
            throw new Error(`Invalid latitude "${latitude}": precondition -90 <= LATITUDE <= 90 failed.`);
        if (accuracy < 0)
            throw new Error(`Invalid accuracy "${accuracy}": precondition 0 <= ACCURACY failed.`);
        await this._client.send('Emulation.setGeolocationOverride', {
            longitude,
            latitude,
            accuracy,
        });
    }
    /**
     * @returns A target this page was created from.
     */
    target() {
        return this._target;
    }
    /**
     * Get the CDP session client the page belongs to.
     * @internal
     */
    client() {
        return this._client;
    }
    /**
     * Get the browser the page belongs to.
     */
    browser() {
        return this._target.browser();
    }
    /**
     * Get the browser context that the page belongs to.
     */
    browserContext() {
        return this._target.browserContext();
    }
    _onTargetCrashed() {
        this.emit('error', new Error('Page crashed!'));
    }
    _onLogEntryAdded(event) {
        const { level, text, args, source, url, lineNumber } = event.entry;
        if (args)
            args.map((arg) => helper.releaseObject(this._client, arg));
        if (source !== 'worker')
            this.emit("console" /* Console */, new ConsoleMessage(level, text, [], [{ url, lineNumber }]));
    }
    /**
     * @returns The page's main frame.
     * @remarks
     * Page is guaranteed to have a main frame which persists during navigations.
     */
    mainFrame() {
        return this._frameManager.mainFrame();
    }
    get keyboard() {
        return this._keyboard;
    }
    get touchscreen() {
        return this._touchscreen;
    }
    get coverage() {
        return this._coverage;
    }
    get tracing() {
        return this._tracing;
    }
    get accessibility() {
        return this._accessibility;
    }
    /**
     * @returns An array of all frames attached to the page.
     */
    frames() {
        return this._frameManager.frames();
    }
    /**
     * @returns all of the dedicated
     * {@link https://developer.mozilla.org/en-US/docs/Web/API/Web_Workers_API |
     * WebWorkers}
     * associated with the page.
     * @remarks
     * NOTE: This does not contain ServiceWorkers
     */
    workers() {
        return Array.from(this._workers.values());
    }
    /**
     * @param value - Whether to enable request interception.
     *
     * @remarks
     * Activating request interception enables {@link HTTPRequest.abort},
     * {@link HTTPRequest.continue} and {@link HTTPRequest.respond} methods.  This
     * provides the capability to modify network requests that are made by a page.
     *
     * Once request interception is enabled, every request will stall unless it's
     * continued, responded or aborted; or completed using the browser cache.
     *
     * @example
     * An example of a naïve request interceptor that aborts all image requests:
     * ```js
     * const puppeteer = require('puppeteer');
     * (async () => {
     *   const browser = await puppeteer.launch();
     *   const page = await browser.newPage();
     *   await page.setRequestInterception(true);
     *   page.on('request', interceptedRequest => {
     *     if (interceptedRequest.url().endsWith('.png') ||
     *         interceptedRequest.url().endsWith('.jpg'))
     *       interceptedRequest.abort();
     *     else
     *       interceptedRequest.continue();
     *     });
     *   await page.goto('https://example.com');
     *   await browser.close();
     * })();
     * ```
     * NOTE: Enabling request interception disables page caching.
     */
    async setRequestInterception(value) {
        return this._frameManager.networkManager().setRequestInterception(value);
    }
    /**
     * @param enabled - Whether to enable drag interception.
     *
     * @remarks
     * Activating drag interception enables the `Input.drag`,
     * methods  This provides the capability to capture drag events emitted
     * on the page, which can then be used to simulate drag-and-drop.
     */
    async setDragInterception(enabled) {
        this._userDragInterceptionEnabled = enabled;
        return this._client.send('Input.setInterceptDrags', { enabled });
    }
    /**
     * @param enabled - When `true`, enables offline mode for the page.
     * @remarks
     * NOTE: while this method sets the network connection to offline, it does
     * not change the parameters used in [page.emulateNetworkConditions(networkConditions)]
     * (#pageemulatenetworkconditionsnetworkconditions)
     */
    setOfflineMode(enabled) {
        return this._frameManager.networkManager().setOfflineMode(enabled);
    }
    /**
     * @param networkConditions - Passing `null` disables network condition emulation.
     * @example
     * ```js
     * const puppeteer = require('puppeteer');
     * const slow3G = puppeteer.networkConditions['Slow 3G'];
     *
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * await page.emulateNetworkConditions(slow3G);
     * await page.goto('https://www.google.com');
     * // other actions...
     * await browser.close();
     * })();
     * ```
     * @remarks
     * NOTE: This does not affect WebSockets and WebRTC PeerConnections (see
     * https://crbug.com/563644). To set the page offline, you can use
     * [page.setOfflineMode(enabled)](#pagesetofflinemodeenabled).
     */
    emulateNetworkConditions(networkConditions) {
        return this._frameManager
            .networkManager()
            .emulateNetworkConditions(networkConditions);
    }
    /**
     * This setting will change the default maximum navigation time for the
     * following methods and related shortcuts:
     *
     * - {@link Page.goBack | page.goBack(options)}
     *
     * - {@link Page.goForward | page.goForward(options)}
     *
     * - {@link Page.goto | page.goto(url,options)}
     *
     * - {@link Page.reload | page.reload(options)}
     *
     * - {@link Page.setContent | page.setContent(html,options)}
     *
     * - {@link Page.waitForNavigation | page.waitForNavigation(options)}
     * @param timeout - Maximum navigation time in milliseconds.
     */
    setDefaultNavigationTimeout(timeout) {
        this._timeoutSettings.setDefaultNavigationTimeout(timeout);
    }
    /**
     * @param timeout - Maximum time in milliseconds.
     */
    setDefaultTimeout(timeout) {
        this._timeoutSettings.setDefaultTimeout(timeout);
    }
    /**
     * Runs `document.querySelector` within the page. If no element matches the
     * selector, the return value resolves to `null`.
     *
     * @remarks
     * Shortcut for {@link Frame.$ | Page.mainFrame().$(selector) }.
     *
     * @param selector - A `selector` to query page for
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector}
     * to query page for.
     */
    async $(selector) {
        return this.mainFrame().$(selector);
    }
    /**
     * @remarks
     *
     * The only difference between {@link Page.evaluate | page.evaluate} and
     * `page.evaluateHandle` is that `evaluateHandle` will return the value
     * wrapped in an in-page object.
     *
     * If the function passed to `page.evaluteHandle` returns a Promise, the
     * function will wait for the promise to resolve and return its value.
     *
     * You can pass a string instead of a function (although functions are
     * recommended as they are easier to debug and use with TypeScript):
     *
     * @example
     * ```
     * const aHandle = await page.evaluateHandle('document')
     * ```
     *
     * @example
     * {@link JSHandle} instances can be passed as arguments to the `pageFunction`:
     * ```
     * const aHandle = await page.evaluateHandle(() => document.body);
     * const resultHandle = await page.evaluateHandle(body => body.innerHTML, aHandle);
     * console.log(await resultHandle.jsonValue());
     * await resultHandle.dispose();
     * ```
     *
     * Most of the time this function returns a {@link JSHandle},
     * but if `pageFunction` returns a reference to an element,
     * you instead get an {@link ElementHandle} back:
     *
     * @example
     * ```
     * const button = await page.evaluateHandle(() => document.querySelector('button'));
     * // can call `click` because `button` is an `ElementHandle`
     * await button.click();
     * ```
     *
     * The TypeScript definitions assume that `evaluateHandle` returns
     *  a `JSHandle`, but if you know it's going to return an
     * `ElementHandle`, pass it as the generic argument:
     *
     * ```
     * const button = await page.evaluateHandle<ElementHandle>(...);
     * ```
     *
     * @param pageFunction - a function that is run within the page
     * @param args - arguments to be passed to the pageFunction
     */
    async evaluateHandle(pageFunction, ...args) {
        const context = await this.mainFrame().executionContext();
        return context.evaluateHandle(pageFunction, ...args);
    }
    /**
     * This method iterates the JavaScript heap and finds all objects with the
     * given prototype.
     *
     * @remarks
     * Shortcut for
     * {@link ExecutionContext.queryObjects |
     * page.mainFrame().executionContext().queryObjects(prototypeHandle)}.
     *
     * @example
     *
     * ```js
     * // Create a Map object
     * await page.evaluate(() => window.map = new Map());
     * // Get a handle to the Map object prototype
     * const mapPrototype = await page.evaluateHandle(() => Map.prototype);
     * // Query all map instances into an array
     * const mapInstances = await page.queryObjects(mapPrototype);
     * // Count amount of map objects in heap
     * const count = await page.evaluate(maps => maps.length, mapInstances);
     * await mapInstances.dispose();
     * await mapPrototype.dispose();
     * ```
     * @param prototypeHandle - a handle to the object prototype.
     * @returns Promise which resolves to a handle to an array of objects with
     * this prototype.
     */
    async queryObjects(prototypeHandle) {
        const context = await this.mainFrame().executionContext();
        return context.queryObjects(prototypeHandle);
    }
    /**
     * This method runs `document.querySelector` within the page and passes the
     * result as the first argument to the `pageFunction`.
     *
     * @remarks
     *
     * If no element is found matching `selector`, the method will throw an error.
     *
     * If `pageFunction` returns a promise `$eval` will wait for the promise to
     * resolve and then return its value.
     *
     * @example
     *
     * ```
     * const searchValue = await page.$eval('#search', el => el.value);
     * const preloadHref = await page.$eval('link[rel=preload]', el => el.href);
     * const html = await page.$eval('.main-container', el => el.outerHTML);
     * ```
     *
     * If you are using TypeScript, you may have to provide an explicit type to the
     * first argument of the `pageFunction`.
     * By default it is typed as `Element`, but you may need to provide a more
     * specific sub-type:
     *
     * @example
     *
     * ```
     * // if you don't provide HTMLInputElement here, TS will error
     * // as `value` is not on `Element`
     * const searchValue = await page.$eval('#search', (el: HTMLInputElement) => el.value);
     * ```
     *
     * The compiler should be able to infer the return type
     * from the `pageFunction` you provide. If it is unable to, you can use the generic
     * type to tell the compiler what return type you expect from `$eval`:
     *
     * @example
     *
     * ```
     * // The compiler can infer the return type in this case, but if it can't
     * // or if you want to be more explicit, provide it as the generic type.
     * const searchValue = await page.$eval<string>(
     *  '#search', (el: HTMLInputElement) => el.value
     * );
     * ```
     *
     * @param selector - the
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector}
     * to query for
     * @param pageFunction - the function to be evaluated in the page context.
     * Will be passed the result of `document.querySelector(selector)` as its
     * first argument.
     * @param args - any additional arguments to pass through to `pageFunction`.
     *
     * @returns The result of calling `pageFunction`. If it returns an element it
     * is wrapped in an {@link ElementHandle}, else the raw value itself is
     * returned.
     */
    async $eval(selector, pageFunction, ...args) {
        return this.mainFrame().$eval(selector, pageFunction, ...args);
    }
    /**
     * This method runs `Array.from(document.querySelectorAll(selector))` within
     * the page and passes the result as the first argument to the `pageFunction`.
     *
     * @remarks
     *
     * If `pageFunction` returns a promise `$$eval` will wait for the promise to
     * resolve and then return its value.
     *
     * @example
     *
     * ```
     * // get the amount of divs on the page
     * const divCount = await page.$$eval('div', divs => divs.length);
     *
     * // get the text content of all the `.options` elements:
     * const options = await page.$$eval('div > span.options', options => {
     *   return options.map(option => option.textContent)
     * });
     * ```
     *
     * If you are using TypeScript, you may have to provide an explicit type to the
     * first argument of the `pageFunction`.
     * By default it is typed as `Element[]`, but you may need to provide a more
     * specific sub-type:
     *
     * @example
     *
     * ```
     * // if you don't provide HTMLInputElement here, TS will error
     * // as `value` is not on `Element`
     * await page.$$eval('input', (elements: HTMLInputElement[]) => {
     *   return elements.map(e => e.value);
     * });
     * ```
     *
     * The compiler should be able to infer the return type
     * from the `pageFunction` you provide. If it is unable to, you can use the generic
     * type to tell the compiler what return type you expect from `$$eval`:
     *
     * @example
     *
     * ```
     * // The compiler can infer the return type in this case, but if it can't
     * // or if you want to be more explicit, provide it as the generic type.
     * const allInputValues = await page.$$eval<string[]>(
     *  'input', (elements: HTMLInputElement[]) => elements.map(e => e.textContent)
     * );
     * ```
     *
     * @param selector - the
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector}
     * to query for
     * @param pageFunction - the function to be evaluated in the page context. Will
     * be passed the result of `Array.from(document.querySelectorAll(selector))`
     * as its first argument.
     * @param args - any additional arguments to pass through to `pageFunction`.
     *
     * @returns The result of calling `pageFunction`. If it returns an element it
     * is wrapped in an {@link ElementHandle}, else the raw value itself is
     * returned.
     */
    async $$eval(selector, pageFunction, ...args) {
        return this.mainFrame().$$eval(selector, pageFunction, ...args);
    }
    /**
     * The method runs `document.querySelectorAll` within the page. If no elements
     * match the selector, the return value resolves to `[]`.
     * @remarks
     * Shortcut for {@link Frame.$$ | Page.mainFrame().$$(selector) }.
     * @param selector - A `selector` to query page for
     */
    async $$(selector) {
        return this.mainFrame().$$(selector);
    }
    /**
     * The method evaluates the XPath expression relative to the page document as
     * its context node. If there are no such elements, the method resolves to an
     * empty array.
     * @remarks
     * Shortcut for {@link Frame.$x | Page.mainFrame().$x(expression) }.
     * @param expression - Expression to evaluate
     */
    async $x(expression) {
        return this.mainFrame().$x(expression);
    }
    /**
     * If no URLs are specified, this method returns cookies for the current page
     * URL. If URLs are specified, only cookies for those URLs are returned.
     */
    async cookies(...urls) {
        const originalCookies = (await this._client.send('Network.getCookies', {
            urls: urls.length ? urls : [this.url()],
        })).cookies;
        const unsupportedCookieAttributes = ['priority'];
        const filterUnsupportedAttributes = (cookie) => {
            for (const attr of unsupportedCookieAttributes)
                delete cookie[attr];
            return cookie;
        };
        return originalCookies.map(filterUnsupportedAttributes);
    }
    async deleteCookie(...cookies) {
        const pageURL = this.url();
        for (const cookie of cookies) {
            const item = Object.assign({}, cookie);
            if (!cookie.url && pageURL.startsWith('http'))
                item.url = pageURL;
            await this._client.send('Network.deleteCookies', item);
        }
    }
    /**
     * @example
     * ```js
     * await page.setCookie(cookieObject1, cookieObject2);
     * ```
     */
    async setCookie(...cookies) {
        const pageURL = this.url();
        const startsWithHTTP = pageURL.startsWith('http');
        const items = cookies.map((cookie) => {
            const item = Object.assign({}, cookie);
            if (!item.url && startsWithHTTP)
                item.url = pageURL;
            assert(item.url !== 'about:blank', `Blank page can not have cookie "${item.name}"`);
            assert(!String.prototype.startsWith.call(item.url || '', 'data:'), `Data URL page can not have cookie "${item.name}"`);
            return item;
        });
        await this.deleteCookie(...items);
        if (items.length)
            await this._client.send('Network.setCookies', { cookies: items });
    }
    /**
     * Adds a `<script>` tag into the page with the desired URL or content.
     * @remarks
     * Shortcut for {@link Frame.addScriptTag | page.mainFrame().addScriptTag(options) }.
     * @returns Promise which resolves to the added tag when the script's onload fires or
     * when the script content was injected into frame.
     */
    async addScriptTag(options) {
        return this.mainFrame().addScriptTag(options);
    }
    /**
     * Adds a `<link rel="stylesheet">` tag into the page with the desired URL or a
     * `<style type="text/css">` tag with the content.
     * @returns Promise which resolves to the added tag when the stylesheet's
     * onload fires or when the CSS content was injected into frame.
     */
    async addStyleTag(options) {
        return this.mainFrame().addStyleTag(options);
    }
    /**
     * The method adds a function called `name` on the page's `window` object. When
     * called, the function executes `puppeteerFunction` in node.js and returns a
     * `Promise` which resolves to the return value of `puppeteerFunction`.
     *
     * If the puppeteerFunction returns a `Promise`, it will be awaited.
     *
     * NOTE: Functions installed via `page.exposeFunction` survive navigations.
     * @param name - Name of the function on the window object
     * @param puppeteerFunction -  Callback function which will be called in
     * Puppeteer's context.
     * @example
     * An example of adding an `md5` function into the page:
     * ```js
     * const puppeteer = require('puppeteer');
     * const crypto = require('crypto');
     *
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * page.on('console', (msg) => console.log(msg.text()));
     * await page.exposeFunction('md5', (text) =>
     * crypto.createHash('md5').update(text).digest('hex')
     * );
     * await page.evaluate(async () => {
     * // use window.md5 to compute hashes
     * const myString = 'PUPPETEER';
     * const myHash = await window.md5(myString);
     * console.log(`md5 of ${myString} is ${myHash}`);
     * });
     * await browser.close();
     * })();
     * ```
     * An example of adding a `window.readfile` function into the page:
     * ```js
     * const puppeteer = require('puppeteer');
     * const fs = require('fs');
     *
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * page.on('console', (msg) => console.log(msg.text()));
     * await page.exposeFunction('readfile', async (filePath) => {
     * return new Promise((resolve, reject) => {
     * fs.readFile(filePath, 'utf8', (err, text) => {
     *    if (err) reject(err);
     *    else resolve(text);
     *  });
     * });
     * });
     * await page.evaluate(async () => {
     * // use window.readfile to read contents of a file
     * const content = await window.readfile('/etc/hosts');
     * console.log(content);
     * });
     * await browser.close();
     * })();
     * ```
     */
    async exposeFunction(name, puppeteerFunction) {
        if (this._pageBindings.has(name))
            throw new Error(`Failed to add page binding with name ${name}: window['${name}'] already exists!`);
        let exposedFunction;
        if (typeof puppeteerFunction === 'function') {
            exposedFunction = puppeteerFunction;
        }
        else if (typeof puppeteerFunction.default === 'function') {
            exposedFunction = puppeteerFunction.default;
        }
        else {
            throw new Error(`Failed to add page binding with name ${name}: ${puppeteerFunction} is not a function or a module with a default export.`);
        }
        this._pageBindings.set(name, exposedFunction);
        const expression = helper.pageBindingInitString('exposedFun', name);
        await this._client.send('Runtime.addBinding', { name: name });
        await this._client.send('Page.addScriptToEvaluateOnNewDocument', {
            source: expression,
        });
        await Promise.all(this.frames().map((frame) => frame.evaluate(expression).catch(debugError)));
    }
    /**
     * Provide credentials for `HTTP authentication`.
     * @remarks To disable authentication, pass `null`.
     */
    async authenticate(credentials) {
        return this._frameManager.networkManager().authenticate(credentials);
    }
    /**
     * The extra HTTP headers will be sent with every request the page initiates.
     * NOTE: All HTTP header names are lowercased. (HTTP headers are
     * case-insensitive, so this shouldn’t impact your server code.)
     * NOTE: page.setExtraHTTPHeaders does not guarantee the order of headers in
     * the outgoing requests.
     * @param headers - An object containing additional HTTP headers to be sent
     * with every request. All header values must be strings.
     * @returns
     */
    async setExtraHTTPHeaders(headers) {
        return this._frameManager.networkManager().setExtraHTTPHeaders(headers);
    }
    /**
     * @param userAgent - Specific user agent to use in this page
     * @param userAgentData - Specific user agent client hint data to use in this
     * page
     * @returns Promise which resolves when the user agent is set.
     */
    async setUserAgent(userAgent, userAgentMetadata) {
        return this._frameManager
            .networkManager()
            .setUserAgent(userAgent, userAgentMetadata);
    }
    /**
     * @returns Object containing metrics as key/value pairs.
     *
     * - `Timestamp` : The timestamp when the metrics sample was taken.
     *
     * - `Documents` : Number of documents in the page.
     *
     * - `Frames` : Number of frames in the page.
     *
     * - `JSEventListeners` : Number of events in the page.
     *
     * - `Nodes` : Number of DOM nodes in the page.
     *
     * - `LayoutCount` : Total number of full or partial page layout.
     *
     * - `RecalcStyleCount` : Total number of page style recalculations.
     *
     * - `LayoutDuration` : Combined durations of all page layouts.
     *
     * - `RecalcStyleDuration` : Combined duration of all page style
     *   recalculations.
     *
     * - `ScriptDuration` : Combined duration of JavaScript execution.
     *
     * - `TaskDuration` : Combined duration of all tasks performed by the browser.
     *
     *
     * - `JSHeapUsedSize` : Used JavaScript heap size.
     *
     * - `JSHeapTotalSize` : Total JavaScript heap size.
     * @remarks
     * NOTE: All timestamps are in monotonic time: monotonically increasing time
     * in seconds since an arbitrary point in the past.
     */
    async metrics() {
        const response = await this._client.send('Performance.getMetrics');
        return this._buildMetricsObject(response.metrics);
    }
    _emitMetrics(event) {
        this.emit("metrics" /* Metrics */, {
            title: event.title,
            metrics: this._buildMetricsObject(event.metrics),
        });
    }
    _buildMetricsObject(metrics) {
        const result = {};
        for (const metric of metrics || []) {
            if (supportedMetrics.has(metric.name))
                result[metric.name] = metric.value;
        }
        return result;
    }
    _handleException(exceptionDetails) {
        const message = helper.getExceptionMessage(exceptionDetails);
        const err = new Error(message);
        err.stack = ''; // Don't report clientside error with a node stack attached
        this.emit("pageerror" /* PageError */, err);
    }
    async _onConsoleAPI(event) {
        if (event.executionContextId === 0) {
            // DevTools protocol stores the last 1000 console messages. These
            // messages are always reported even for removed execution contexts. In
            // this case, they are marked with executionContextId = 0 and are
            // reported upon enabling Runtime agent.
            //
            // Ignore these messages since:
            // - there's no execution context we can use to operate with message
            //   arguments
            // - these messages are reported before Puppeteer clients can subscribe
            //   to the 'console'
            //   page event.
            //
            // @see https://github.com/puppeteer/puppeteer/issues/3865
            return;
        }
        const context = this._frameManager.executionContextById(event.executionContextId, this._client);
        const values = event.args.map((arg) => createJSHandle(context, arg));
        this._addConsoleMessage(event.type, values, event.stackTrace);
    }
    async _onBindingCalled(event) {
        let payload;
        try {
            payload = JSON.parse(event.payload);
        }
        catch {
            // The binding was either called by something in the page or it was
            // called before our wrapper was initialized.
            return;
        }
        const { type, name, seq, args } = payload;
        if (type !== 'exposedFun' || !this._pageBindings.has(name))
            return;
        let expression = null;
        try {
            const result = await this._pageBindings.get(name)(...args);
            expression = helper.pageBindingDeliverResultString(name, seq, result);
        }
        catch (error) {
            if (error instanceof Error)
                expression = helper.pageBindingDeliverErrorString(name, seq, error.message, error.stack);
            else
                expression = helper.pageBindingDeliverErrorValueString(name, seq, error);
        }
        this._client
            .send('Runtime.evaluate', {
            expression,
            contextId: event.executionContextId,
        })
            .catch(debugError);
    }
    _addConsoleMessage(type, args, stackTrace) {
        if (!this.listenerCount("console" /* Console */)) {
            args.forEach((arg) => arg.dispose());
            return;
        }
        const textTokens = [];
        for (const arg of args) {
            const remoteObject = arg._remoteObject;
            if (remoteObject.objectId)
                textTokens.push(arg.toString());
            else
                textTokens.push(helper.valueFromRemoteObject(remoteObject));
        }
        const stackTraceLocations = [];
        if (stackTrace) {
            for (const callFrame of stackTrace.callFrames) {
                stackTraceLocations.push({
                    url: callFrame.url,
                    lineNumber: callFrame.lineNumber,
                    columnNumber: callFrame.columnNumber,
                });
            }
        }
        const message = new ConsoleMessage(type, textTokens.join(' '), args, stackTraceLocations);
        this.emit("console" /* Console */, message);
    }
    _onDialog(event) {
        let dialogType = null;
        const validDialogTypes = new Set([
            'alert',
            'confirm',
            'prompt',
            'beforeunload',
        ]);
        if (validDialogTypes.has(event.type)) {
            dialogType = event.type;
        }
        assert(dialogType, 'Unknown javascript dialog type: ' + event.type);
        const dialog = new Dialog(this._client, dialogType, event.message, event.defaultPrompt);
        this.emit("dialog" /* Dialog */, dialog);
    }
    /**
     * Resets default white background
     */
    async _resetDefaultBackgroundColor() {
        await this._client.send('Emulation.setDefaultBackgroundColorOverride');
    }
    /**
     * Hides default white background
     */
    async _setTransparentBackgroundColor() {
        await this._client.send('Emulation.setDefaultBackgroundColorOverride', {
            color: { r: 0, g: 0, b: 0, a: 0 },
        });
    }
    /**
     *
     * @returns
     * @remarks Shortcut for
     * {@link Frame.url | page.mainFrame().url()}.
     */
    url() {
        return this.mainFrame().url();
    }
    async content() {
        return await this._frameManager.mainFrame().content();
    }
    /**
     * @param html - HTML markup to assign to the page.
     * @param options - Parameters that has some properties.
     * @remarks
     * The parameter `options` might have the following options.
     *
     * - `timeout` : Maximum time in milliseconds for resources to load, defaults
     *   to 30 seconds, pass `0` to disable timeout. The default value can be
     *   changed by using the
     *   {@link Page.setDefaultNavigationTimeout |
     *   page.setDefaultNavigationTimeout(timeout)}
     *   or {@link Page.setDefaultTimeout | page.setDefaultTimeout(timeout)}
     *   methods.
     *
     * - `waitUntil`: When to consider setting markup succeeded, defaults to `load`.
     *    Given an array of event strings, setting content is considered to be
     *    successful after all events have been fired. Events can be either:<br/>
     *  - `load` : consider setting content to be finished when the `load` event is
     *    fired.<br/>
     *  - `domcontentloaded` : consider setting content to be finished when the
     *   `DOMContentLoaded` event is fired.<br/>
     *  - `networkidle0` : consider setting content to be finished when there are no
     *   more than 0 network connections for at least `500` ms.<br/>
     *  - `networkidle2` : consider setting content to be finished when there are no
     *   more than 2 network connections for at least `500` ms.
     */
    async setContent(html, options = {}) {
        await this._frameManager.mainFrame().setContent(html, options);
    }
    /**
     * @param url - URL to navigate page to. The URL should include scheme, e.g.
     * `https://`
     * @param options - Navigation Parameter
     * @returns Promise which resolves to the main resource response. In case of
     * multiple redirects, the navigation will resolve with the response of the
     * last redirect.
     * @remarks
     * The argument `options` might have the following properties:
     *
     * - `timeout` : Maximum navigation time in milliseconds, defaults to 30
     *   seconds, pass 0 to disable timeout. The default value can be changed by
     *   using the
     *   {@link Page.setDefaultNavigationTimeout |
     *   page.setDefaultNavigationTimeout(timeout)}
     *   or {@link Page.setDefaultTimeout | page.setDefaultTimeout(timeout)}
     *   methods.
     *
     * - `waitUntil`:When to consider navigation succeeded, defaults to `load`.
     *    Given an array of event strings, navigation is considered to be successful
     *    after all events have been fired. Events can be either:<br/>
     *  - `load` : consider navigation to be finished when the load event is
     *    fired.<br/>
     *  - `domcontentloaded` : consider navigation to be finished when the
     *    DOMContentLoaded event is fired.<br/>
     *  - `networkidle0` : consider navigation to be finished when there are no
     *    more than 0 network connections for at least `500` ms.<br/>
     *  - `networkidle2` : consider navigation to be finished when there are no
     *    more than 2 network connections for at least `500` ms.
     *
     * - `referer` : Referer header value. If provided it will take preference
     *   over the referer header value set by
     *   {@link Page.setExtraHTTPHeaders |page.setExtraHTTPHeaders()}.
     *
     * `page.goto` will throw an error if:
     * - there's an SSL error (e.g. in case of self-signed certificates).
     * - target URL is invalid.
     * - the timeout is exceeded during navigation.
     * - the remote server does not respond or is unreachable.
     * - the main resource failed to load.
     *
     * `page.goto` will not throw an error when any valid HTTP status code is
     *   returned by the remote server, including 404 "Not Found" and 500
     *   "Internal Server Error". The status code for such responses can be
     *   retrieved by calling response.status().
     *
     * NOTE: `page.goto` either throws an error or returns a main resource
     * response. The only exceptions are navigation to about:blank or navigation
     * to the same URL with a different hash, which would succeed and return null.
     *
     * NOTE: Headless mode doesn't support navigation to a PDF document. See the
     * {@link https://bugs.chromium.org/p/chromium/issues/detail?id=761295
     * | upstream issue}.
     *
     * Shortcut for {@link Frame.goto | page.mainFrame().goto(url, options)}.
     */
    async goto(url, options = {}) {
        return await this._frameManager.mainFrame().goto(url, options);
    }
    /**
     * @param options - Navigation parameters which might have the following
     * properties:
     * @returns Promise which resolves to the main resource response. In case of
     * multiple redirects, the navigation will resolve with the response of the
     * last redirect.
     * @remarks
     * The argument `options` might have the following properties:
     *
     * - `timeout` : Maximum navigation time in milliseconds, defaults to 30
     *   seconds, pass 0 to disable timeout. The default value can be changed by
     *   using the
     *   {@link Page.setDefaultNavigationTimeout |
     *   page.setDefaultNavigationTimeout(timeout)}
     *   or {@link Page.setDefaultTimeout | page.setDefaultTimeout(timeout)}
     *   methods.
     *
     * - `waitUntil`: When to consider navigation succeeded, defaults to `load`.
     *    Given an array of event strings, navigation is considered to be
     *    successful after all events have been fired. Events can be either:<br/>
     *  - `load` : consider navigation to be finished when the load event is fired.<br/>
     *  - `domcontentloaded` : consider navigation to be finished when the
     *   DOMContentLoaded event is fired.<br/>
     *  - `networkidle0` : consider navigation to be finished when there are no
     *   more than 0 network connections for at least `500` ms.<br/>
     *  - `networkidle2` : consider navigation to be finished when there are no
     *   more than 2 network connections for at least `500` ms.
     */
    async reload(options) {
        const result = await Promise.all([
            this.waitForNavigation(options),
            this._client.send('Page.reload'),
        ]);
        return result[0];
    }
    /**
     * This resolves when the page navigates to a new URL or reloads. It is useful
     * when you run code that will indirectly cause the page to navigate. Consider
     * this example:
     * ```js
     * const [response] = await Promise.all([
     * page.waitForNavigation(), // The promise resolves after navigation has finished
     * page.click('a.my-link'), // Clicking the link will indirectly cause a navigation
     * ]);
     * ```
     *
     * @param options - Navigation parameters which might have the following properties:
     * @returns Promise which resolves to the main resource response. In case of
     * multiple redirects, the navigation will resolve with the response of the
     * last redirect. In case of navigation to a different anchor or navigation
     * due to History API usage, the navigation will resolve with `null`.
     * @remarks
     * NOTE: Usage of the
     * {@link https://developer.mozilla.org/en-US/docs/Web/API/History_API | History API}
     * to change the URL is considered a navigation.
     *
     * Shortcut for
     * {@link Frame.waitForNavigation | page.mainFrame().waitForNavigation(options)}.
     */
    async waitForNavigation(options = {}) {
        return await this._frameManager.mainFrame().waitForNavigation(options);
    }
    _sessionClosePromise() {
        if (!this._disconnectPromise)
            this._disconnectPromise = new Promise((fulfill) => this._client.once(CDPSessionEmittedEvents.Disconnected, () => fulfill(new Error('Target closed'))));
        return this._disconnectPromise;
    }
    /**
     * @param urlOrPredicate - A URL or predicate to wait for
     * @param options - Optional waiting parameters
     * @returns Promise which resolves to the matched response
     * @example
     * ```js
     * const firstResponse = await page.waitForResponse(
     * 'https://example.com/resource'
     * );
     * const finalResponse = await page.waitForResponse(
     * (response) =>
     * response.url() === 'https://example.com' && response.status() === 200
     * );
     * const finalResponse = await page.waitForResponse(async (response) => {
     * return (await response.text()).includes('<html>');
     * });
     * return finalResponse.ok();
     * ```
     * @remarks
     * Optional Waiting Parameters have:
     *
     * - `timeout`: Maximum wait time in milliseconds, defaults to `30` seconds, pass
     * `0` to disable the timeout. The default value can be changed by using the
     * {@link Page.setDefaultTimeout} method.
     */
    async waitForRequest(urlOrPredicate, options = {}) {
        const { timeout = this._timeoutSettings.timeout() } = options;
        return helper.waitForEvent(this._frameManager.networkManager(), NetworkManagerEmittedEvents.Request, (request) => {
            if (helper.isString(urlOrPredicate))
                return urlOrPredicate === request.url();
            if (typeof urlOrPredicate === 'function')
                return !!urlOrPredicate(request);
            return false;
        }, timeout, this._sessionClosePromise());
    }
    /**
     * @param urlOrPredicate - A URL or predicate to wait for.
     * @param options - Optional waiting parameters
     * @returns Promise which resolves to the matched response.
     * @example
     * ```js
     * const firstResponse = await page.waitForResponse(
     * 'https://example.com/resource'
     * );
     * const finalResponse = await page.waitForResponse(
     * (response) =>
     * response.url() === 'https://example.com' && response.status() === 200
     * );
     * const finalResponse = await page.waitForResponse(async (response) => {
     * return (await response.text()).includes('<html>');
     * });
     * return finalResponse.ok();
     * ```
     * @remarks
     * Optional Parameter have:
     *
     * - `timeout`: Maximum wait time in milliseconds, defaults to `30` seconds,
     * pass `0` to disable the timeout. The default value can be changed by using
     * the {@link Page.setDefaultTimeout} method.
     */
    async waitForResponse(urlOrPredicate, options = {}) {
        const { timeout = this._timeoutSettings.timeout() } = options;
        return helper.waitForEvent(this._frameManager.networkManager(), NetworkManagerEmittedEvents.Response, async (response) => {
            if (helper.isString(urlOrPredicate))
                return urlOrPredicate === response.url();
            if (typeof urlOrPredicate === 'function')
                return !!(await urlOrPredicate(response));
            return false;
        }, timeout, this._sessionClosePromise());
    }
    /**
     * @param options - Optional waiting parameters
     * @returns Promise which resolves when network is idle
     */
    async waitForNetworkIdle(options = {}) {
        const { idleTime = 500, timeout = this._timeoutSettings.timeout() } = options;
        const networkManager = this._frameManager.networkManager();
        let idleResolveCallback;
        const idlePromise = new Promise((resolve) => {
            idleResolveCallback = resolve;
        });
        let abortRejectCallback;
        const abortPromise = new Promise((_, reject) => {
            abortRejectCallback = reject;
        });
        let idleTimer;
        const onIdle = () => idleResolveCallback();
        const cleanup = () => {
            idleTimer && clearTimeout(idleTimer);
            abortRejectCallback(new Error('abort'));
        };
        const evaluate = () => {
            idleTimer && clearTimeout(idleTimer);
            if (networkManager.numRequestsInProgress() === 0)
                idleTimer = setTimeout(onIdle, idleTime);
        };
        evaluate();
        const eventHandler = () => {
            evaluate();
            return false;
        };
        const listenToEvent = (event) => helper.waitForEvent(networkManager, event, eventHandler, timeout, abortPromise);
        const eventPromises = [
            listenToEvent(NetworkManagerEmittedEvents.Request),
            listenToEvent(NetworkManagerEmittedEvents.Response),
        ];
        await Promise.race([
            idlePromise,
            ...eventPromises,
            this._sessionClosePromise(),
        ]).then((r) => {
            cleanup();
            return r;
        }, (error) => {
            cleanup();
            throw error;
        });
    }
    /**
     * @param urlOrPredicate - A URL or predicate to wait for.
     * @param options - Optional waiting parameters
     * @returns Promise which resolves to the matched frame.
     * @example
     * ```js
     * const frame = await page.waitForFrame(async (frame) => {
     *   return frame.name() === 'Test';
     * });
     * ```
     * @remarks
     * Optional Parameter have:
     *
     * - `timeout`: Maximum wait time in milliseconds, defaults to `30` seconds,
     * pass `0` to disable the timeout. The default value can be changed by using
     * the {@link Page.setDefaultTimeout} method.
     */
    async waitForFrame(urlOrPredicate, options = {}) {
        const { timeout = this._timeoutSettings.timeout() } = options;
        async function predicate(frame) {
            if (helper.isString(urlOrPredicate))
                return urlOrPredicate === frame.url();
            if (typeof urlOrPredicate === 'function')
                return !!(await urlOrPredicate(frame));
            return false;
        }
        return Promise.race([
            helper.waitForEvent(this._frameManager, FrameManagerEmittedEvents.FrameAttached, predicate, timeout, this._sessionClosePromise()),
            helper.waitForEvent(this._frameManager, FrameManagerEmittedEvents.FrameNavigated, predicate, timeout, this._sessionClosePromise()),
        ]);
    }
    /**
     * This method navigate to the previous page in history.
     * @param options - Navigation parameters
     * @returns Promise which resolves to the main resource response. In case of
     * multiple redirects, the navigation will resolve with the response of the
     * last redirect. If can not go back, resolves to `null`.
     * @remarks
     * The argument `options` might have the following properties:
     *
     * - `timeout` : Maximum navigation time in milliseconds, defaults to 30
     *   seconds, pass 0 to disable timeout. The default value can be changed by
     *   using the
     *   {@link Page.setDefaultNavigationTimeout
     *   | page.setDefaultNavigationTimeout(timeout)}
     *   or {@link Page.setDefaultTimeout | page.setDefaultTimeout(timeout)}
     *   methods.
     *
     * - `waitUntil` : When to consider navigation succeeded, defaults to `load`.
     *    Given an array of event strings, navigation is considered to be
     *    successful after all events have been fired. Events can be either:<br/>
     *  - `load` : consider navigation to be finished when the load event is fired.<br/>
     *  - `domcontentloaded` : consider navigation to be finished when the
     *   DOMContentLoaded event is fired.<br/>
     *  - `networkidle0` : consider navigation to be finished when there are no
     *   more than 0 network connections for at least `500` ms.<br/>
     *  - `networkidle2` : consider navigation to be finished when there are no
     *   more than 2 network connections for at least `500` ms.
     */
    async goBack(options = {}) {
        return this._go(-1, options);
    }
    /**
     * This method navigate to the next page in history.
     * @param options - Navigation Parameter
     * @returns Promise which resolves to the main resource response. In case of
     * multiple redirects, the navigation will resolve with the response of the
     * last redirect. If can not go forward, resolves to `null`.
     * @remarks
     * The argument `options` might have the following properties:
     *
     * - `timeout` : Maximum navigation time in milliseconds, defaults to 30
     *   seconds, pass 0 to disable timeout. The default value can be changed by
     *   using the
     *   {@link Page.setDefaultNavigationTimeout
     *   | page.setDefaultNavigationTimeout(timeout)}
     *   or {@link Page.setDefaultTimeout | page.setDefaultTimeout(timeout)}
     *   methods.
     *
     * - `waitUntil`: When to consider navigation succeeded, defaults to `load`.
     *    Given an array of event strings, navigation is considered to be
     *    successful after all events have been fired. Events can be either:<br/>
     *  - `load` : consider navigation to be finished when the load event is fired.<br/>
     *  - `domcontentloaded` : consider navigation to be finished when the
     *   DOMContentLoaded event is fired.<br/>
     *  - `networkidle0` : consider navigation to be finished when there are no
     *   more than 0 network connections for at least `500` ms.<br/>
     *  - `networkidle2` : consider navigation to be finished when there are no
     *   more than 2 network connections for at least `500` ms.
     */
    async goForward(options = {}) {
        return this._go(+1, options);
    }
    async _go(delta, options) {
        const history = await this._client.send('Page.getNavigationHistory');
        const entry = history.entries[history.currentIndex + delta];
        if (!entry)
            return null;
        const result = await Promise.all([
            this.waitForNavigation(options),
            this._client.send('Page.navigateToHistoryEntry', { entryId: entry.id }),
        ]);
        return result[0];
    }
    /**
     * Brings page to front (activates tab).
     */
    async bringToFront() {
        await this._client.send('Page.bringToFront');
    }
    /**
     * Emulates given device metrics and user agent. This method is a shortcut for
     * calling two methods: {@link Page.setUserAgent} and {@link Page.setViewport}
     * To aid emulation, Puppeteer provides a list of device descriptors that can
     * be obtained via the {@link Puppeteer.devices} `page.emulate` will resize
     * the page. A lot of websites don't expect phones to change size, so you
     * should emulate before navigating to the page.
     * @example
     * ```js
     * const puppeteer = require('puppeteer');
     * const iPhone = puppeteer.devices['iPhone 6'];
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * await page.emulate(iPhone);
     * await page.goto('https://www.google.com');
     * // other actions...
     * await browser.close();
     * })();
     * ```
     * @remarks List of all available devices is available in the source code:
     * {@link https://github.com/puppeteer/puppeteer/blob/main/src/common/DeviceDescriptors.ts | src/common/DeviceDescriptors.ts}.
     */
    async emulate(options) {
        await Promise.all([
            this.setViewport(options.viewport),
            this.setUserAgent(options.userAgent),
        ]);
    }
    /**
     * @param enabled - Whether or not to enable JavaScript on the page.
     * @returns
     * @remarks
     * NOTE: changing this value won't affect scripts that have already been run.
     * It will take full effect on the next navigation.
     */
    async setJavaScriptEnabled(enabled) {
        if (this._javascriptEnabled === enabled)
            return;
        this._javascriptEnabled = enabled;
        await this._client.send('Emulation.setScriptExecutionDisabled', {
            value: !enabled,
        });
    }
    /**
     * Toggles bypassing page's Content-Security-Policy.
     * @param enabled - sets bypassing of page's Content-Security-Policy.
     * @remarks
     * NOTE: CSP bypassing happens at the moment of CSP initialization rather than
     * evaluation. Usually, this means that `page.setBypassCSP` should be called
     * before navigating to the domain.
     */
    async setBypassCSP(enabled) {
        await this._client.send('Page.setBypassCSP', { enabled });
    }
    /**
     * @param type - Changes the CSS media type of the page. The only allowed
     * values are `screen`, `print` and `null`. Passing `null` disables CSS media
     * emulation.
     * @example
     * ```
     * await page.evaluate(() => matchMedia('screen').matches);
     * // → true
     * await page.evaluate(() => matchMedia('print').matches);
     * // → false
     *
     * await page.emulateMediaType('print');
     * await page.evaluate(() => matchMedia('screen').matches);
     * // → false
     * await page.evaluate(() => matchMedia('print').matches);
     * // → true
     *
     * await page.emulateMediaType(null);
     * await page.evaluate(() => matchMedia('screen').matches);
     * // → true
     * await page.evaluate(() => matchMedia('print').matches);
     * // → false
     * ```
     */
    async emulateMediaType(type) {
        assert(type === 'screen' || type === 'print' || type === null, 'Unsupported media type: ' + type);
        await this._client.send('Emulation.setEmulatedMedia', {
            media: type || '',
        });
    }
    /**
     * Enables CPU throttling to emulate slow CPUs.
     * @param factor - slowdown factor (1 is no throttle, 2 is 2x slowdown, etc).
     */
    async emulateCPUThrottling(factor) {
        assert(factor === null || factor >= 1, 'Throttling rate should be greater or equal to 1');
        await this._client.send('Emulation.setCPUThrottlingRate', {
            rate: factor !== null ? factor : 1,
        });
    }
    /**
     * @param features - `<?Array<Object>>` Given an array of media feature
     * objects, emulates CSS media features on the page. Each media feature object
     * must have the following properties:
     * @example
     * ```js
     * await page.emulateMediaFeatures([
     * { name: 'prefers-color-scheme', value: 'dark' },
     * ]);
     * await page.evaluate(() => matchMedia('(prefers-color-scheme: dark)').matches);
     * // → true
     * await page.evaluate(() => matchMedia('(prefers-color-scheme: light)').matches);
     * // → false
     *
     * await page.emulateMediaFeatures([
     * { name: 'prefers-reduced-motion', value: 'reduce' },
     * ]);
     * await page.evaluate(
     * () => matchMedia('(prefers-reduced-motion: reduce)').matches
     * );
     * // → true
     * await page.evaluate(
     * () => matchMedia('(prefers-reduced-motion: no-preference)').matches
     * );
     * // → false
     *
     * await page.emulateMediaFeatures([
     * { name: 'prefers-color-scheme', value: 'dark' },
     * { name: 'prefers-reduced-motion', value: 'reduce' },
     * ]);
     * await page.evaluate(() => matchMedia('(prefers-color-scheme: dark)').matches);
     * // → true
     * await page.evaluate(() => matchMedia('(prefers-color-scheme: light)').matches);
     * // → false
     * await page.evaluate(
     * () => matchMedia('(prefers-reduced-motion: reduce)').matches
     * );
     * // → true
     * await page.evaluate(
     * () => matchMedia('(prefers-reduced-motion: no-preference)').matches
     * );
     * // → false
     *
     * await page.emulateMediaFeatures([{ name: 'color-gamut', value: 'p3' }]);
     * await page.evaluate(() => matchMedia('(color-gamut: srgb)').matches);
     * // → true
     * await page.evaluate(() => matchMedia('(color-gamut: p3)').matches);
     * // → true
     * await page.evaluate(() => matchMedia('(color-gamut: rec2020)').matches);
     * // → false
     * ```
     */
    async emulateMediaFeatures(features) {
        if (features === null)
            await this._client.send('Emulation.setEmulatedMedia', { features: null });
        if (Array.isArray(features)) {
            features.every((mediaFeature) => {
                const name = mediaFeature.name;
                assert(/^(?:prefers-(?:color-scheme|reduced-motion)|color-gamut)$/.test(name), 'Unsupported media feature: ' + name);
                return true;
            });
            await this._client.send('Emulation.setEmulatedMedia', {
                features: features,
            });
        }
    }
    /**
     * @param timezoneId - Changes the timezone of the page. See
     * {@link https://source.chromium.org/chromium/chromium/deps/icu.git/+/faee8bc70570192d82d2978a71e2a615788597d1:source/data/misc/metaZones.txt | ICU’s metaZones.txt}
     * for a list of supported timezone IDs. Passing
     * `null` disables timezone emulation.
     */
    async emulateTimezone(timezoneId) {
        try {
            await this._client.send('Emulation.setTimezoneOverride', {
                timezoneId: timezoneId || '',
            });
        }
        catch (error) {
            if (error.message.includes('Invalid timezone'))
                throw new Error(`Invalid timezone ID: ${timezoneId}`);
            throw error;
        }
    }
    /**
     * Emulates the idle state.
     * If no arguments set, clears idle state emulation.
     *
     * @example
     * ```js
     * // set idle emulation
     * await page.emulateIdleState({isUserActive: true, isScreenUnlocked: false});
     *
     * // do some checks here
     * ...
     *
     * // clear idle emulation
     * await page.emulateIdleState();
     * ```
     *
     * @param overrides - Mock idle state. If not set, clears idle overrides
     */
    async emulateIdleState(overrides) {
        if (overrides) {
            await this._client.send('Emulation.setIdleOverride', {
                isUserActive: overrides.isUserActive,
                isScreenUnlocked: overrides.isScreenUnlocked,
            });
        }
        else {
            await this._client.send('Emulation.clearIdleOverride');
        }
    }
    /**
     * Simulates the given vision deficiency on the page.
     *
     * @example
     * ```js
     * const puppeteer = require('puppeteer');
     *
     * (async () => {
     *   const browser = await puppeteer.launch();
     *   const page = await browser.newPage();
     *   await page.goto('https://v8.dev/blog/10-years');
     *
     *   await page.emulateVisionDeficiency('achromatopsia');
     *   await page.screenshot({ path: 'achromatopsia.png' });
     *
     *   await page.emulateVisionDeficiency('deuteranopia');
     *   await page.screenshot({ path: 'deuteranopia.png' });
     *
     *   await page.emulateVisionDeficiency('blurredVision');
     *   await page.screenshot({ path: 'blurred-vision.png' });
     *
     *   await browser.close();
     * })();
     * ```
     *
     * @param type - the type of deficiency to simulate, or `'none'` to reset.
     */
    async emulateVisionDeficiency(type) {
        const visionDeficiencies = new Set([
            'none',
            'achromatopsia',
            'blurredVision',
            'deuteranopia',
            'protanopia',
            'tritanopia',
        ]);
        try {
            assert(!type || visionDeficiencies.has(type), `Unsupported vision deficiency: ${type}`);
            await this._client.send('Emulation.setEmulatedVisionDeficiency', {
                type: type || 'none',
            });
        }
        catch (error) {
            throw error;
        }
    }
    /**
     * `page.setViewport` will resize the page. A lot of websites don't expect
     * phones to change size, so you should set the viewport before navigating to
     * the page.
     *
     * In the case of multiple pages in a single browser, each page can have its
     * own viewport size.
     * @example
     * ```js
     * const page = await browser.newPage();
     * await page.setViewport({
     * width: 640,
     * height: 480,
     * deviceScaleFactor: 1,
     * });
     * await page.goto('https://example.com');
     * ```
     *
     * @param viewport -
     * @remarks
     * Argument viewport have following properties:
     *
     * - `width`: page width in pixels. required
     *
     * - `height`: page height in pixels. required
     *
     * - `deviceScaleFactor`: Specify device scale factor (can be thought of as
     *   DPR). Defaults to `1`.
     *
     * - `isMobile`: Whether the meta viewport tag is taken into account. Defaults
     *   to `false`.
     *
     * - `hasTouch`: Specifies if viewport supports touch events. Defaults to `false`
     *
     * - `isLandScape`: Specifies if viewport is in landscape mode. Defaults to false.
     *
     * NOTE: in certain cases, setting viewport will reload the page in order to
     * set the isMobile or hasTouch properties.
     */
    async setViewport(viewport) {
        const needsReload = await this._emulationManager.emulateViewport(viewport);
        this._viewport = viewport;
        if (needsReload)
            await this.reload();
    }
    /**
     * @returns
     *
     * - `width`: page's width in pixels
     *
     * - `height`: page's height in pixels
     *
     * - `deviceScalarFactor`: Specify device scale factor (can be though of as
     *   dpr). Defaults to `1`.
     *
     * - `isMobile`: Whether the meta viewport tag is taken into account. Defaults
     *   to `false`.
     *
     * - `hasTouch`: Specifies if viewport supports touch events. Defaults to
     *   `false`.
     *
     * - `isLandScape`: Specifies if viewport is in landscape mode. Defaults to
     *   `false`.
     */
    viewport() {
        return this._viewport;
    }
    /**
     * @remarks
     *
     * Evaluates a function in the page's context and returns the result.
     *
     * If the function passed to `page.evaluteHandle` returns a Promise, the
     * function will wait for the promise to resolve and return its value.
     *
     * @example
     *
     * ```js
     * const result = await frame.evaluate(() => {
     *   return Promise.resolve(8 * 7);
     * });
     * console.log(result); // prints "56"
     * ```
     *
     * You can pass a string instead of a function (although functions are
     * recommended as they are easier to debug and use with TypeScript):
     *
     * @example
     * ```
     * const aHandle = await page.evaluate('1 + 2');
     * ```
     *
     * To get the best TypeScript experience, you should pass in as the
     * generic the type of `pageFunction`:
     *
     * ```
     * const aHandle = await page.evaluate<() => number>(() => 2);
     * ```
     *
     * @example
     *
     * {@link ElementHandle} instances (including {@link JSHandle}s) can be passed
     * as arguments to the `pageFunction`:
     *
     * ```
     * const bodyHandle = await page.$('body');
     * const html = await page.evaluate(body => body.innerHTML, bodyHandle);
     * await bodyHandle.dispose();
     * ```
     *
     * @param pageFunction - a function that is run within the page
     * @param args - arguments to be passed to the pageFunction
     *
     * @returns the return value of `pageFunction`.
     */
    async evaluate(pageFunction, ...args) {
        return this._frameManager.mainFrame().evaluate(pageFunction, ...args);
    }
    /**
     * Adds a function which would be invoked in one of the following scenarios:
     *
     * - whenever the page is navigated
     *
     * - whenever the child frame is attached or navigated. In this case, the
     * function is invoked in the context of the newly attached frame.
     *
     * The function is invoked after the document was created but before any of
     * its scripts were run. This is useful to amend the JavaScript environment,
     * e.g. to seed `Math.random`.
     * @param pageFunction - Function to be evaluated in browser context
     * @param args - Arguments to pass to `pageFunction`
     * @example
     * An example of overriding the navigator.languages property before the page loads:
     * ```js
     * // preload.js
     *
     * // overwrite the `languages` property to use a custom getter
     * Object.defineProperty(navigator, 'languages', {
     * get: function () {
     * return ['en-US', 'en', 'bn'];
     * },
     * });
     *
     * // In your puppeteer script, assuming the preload.js file is
     * in same folder of our script
     * const preloadFile = fs.readFileSync('./preload.js', 'utf8');
     * await page.evaluateOnNewDocument(preloadFile);
     * ```
     */
    async evaluateOnNewDocument(pageFunction, ...args) {
        const source = helper.evaluationString(pageFunction, ...args);
        await this._client.send('Page.addScriptToEvaluateOnNewDocument', {
            source,
        });
    }
    /**
     * Toggles ignoring cache for each request based on the enabled state. By
     * default, caching is enabled.
     * @param enabled - sets the `enabled` state of cache
     */
    async setCacheEnabled(enabled = true) {
        await this._frameManager.networkManager().setCacheEnabled(enabled);
    }
    /**
     * @remarks
     * Options object which might have the following properties:
     *
     * - `path` : The file path to save the image to. The screenshot type
     *   will be inferred from file extension. If `path` is a relative path, then
     *   it is resolved relative to
     *   {@link https://nodejs.org/api/process.html#process_process_cwd
     *   | current working directory}.
     *   If no path is provided, the image won't be saved to the disk.
     *
     * - `type` : Specify screenshot type, can be either `jpeg` or `png`.
     *   Defaults to 'png'.
     *
     * - `quality` : The quality of the image, between 0-100. Not
     *   applicable to `png` images.
     *
     * - `fullPage` : When true, takes a screenshot of the full
     *   scrollable page. Defaults to `false`
     *
     * - `clip` : An object which specifies clipping region of the page.
     *   Should have the following fields:<br/>
     *  - `x` : x-coordinate of top-left corner of clip area.<br/>
     *  - `y` :  y-coordinate of top-left corner of clip area.<br/>
     *  - `width` : width of clipping area.<br/>
     *  - `height` : height of clipping area.
     *
     * - `omitBackground` : Hides default white background and allows
     *   capturing screenshots with transparency. Defaults to `false`
     *
     * - `encoding` : The encoding of the image, can be either base64 or
     *   binary. Defaults to `binary`.
     *
     *
     * NOTE: Screenshots take at least 1/6 second on OS X. See
     * {@link https://crbug.com/741689} for discussion.
     * @returns Promise which resolves to buffer or a base64 string (depending on
     * the value of `encoding`) with captured screenshot.
     */
    async screenshot(options = {}) {
        let screenshotType = null;
        // options.type takes precedence over inferring the type from options.path
        // because it may be a 0-length file with no extension created beforehand
        // (i.e. as a temp file).
        if (options.type) {
            const type = options.type;
            if (type !== 'png' && type !== 'jpeg' && type !== 'webp') {
                assertNever(type, 'Unknown options.type value: ' + type);
            }
            screenshotType = options.type;
        }
        else if (options.path) {
            const filePath = options.path;
            const extension = filePath
                .slice(filePath.lastIndexOf('.') + 1)
                .toLowerCase();
            if (extension === 'png')
                screenshotType = 'png';
            else if (extension === 'jpg' || extension === 'jpeg')
                screenshotType = 'jpeg';
            else if (extension === 'webp')
                screenshotType = 'webp';
            assert(screenshotType, `Unsupported screenshot type for extension \`.${extension}\``);
        }
        if (!screenshotType)
            screenshotType = 'png';
        if (options.quality) {
            assert(screenshotType === 'jpeg' || screenshotType === 'webp', 'options.quality is unsupported for the ' +
                screenshotType +
                ' screenshots');
            assert(typeof options.quality === 'number', 'Expected options.quality to be a number but found ' +
                typeof options.quality);
            assert(Number.isInteger(options.quality), 'Expected options.quality to be an integer');
            assert(options.quality >= 0 && options.quality <= 100, 'Expected options.quality to be between 0 and 100 (inclusive), got ' +
                options.quality);
        }
        assert(!options.clip || !options.fullPage, 'options.clip and options.fullPage are exclusive');
        if (options.clip) {
            assert(typeof options.clip.x === 'number', 'Expected options.clip.x to be a number but found ' +
                typeof options.clip.x);
            assert(typeof options.clip.y === 'number', 'Expected options.clip.y to be a number but found ' +
                typeof options.clip.y);
            assert(typeof options.clip.width === 'number', 'Expected options.clip.width to be a number but found ' +
                typeof options.clip.width);
            assert(typeof options.clip.height === 'number', 'Expected options.clip.height to be a number but found ' +
                typeof options.clip.height);
            assert(options.clip.width !== 0, 'Expected options.clip.width not to be 0.');
            assert(options.clip.height !== 0, 'Expected options.clip.height not to be 0.');
        }
        return this._screenshotTaskQueue.postTask(() => this._screenshotTask(screenshotType, options));
    }
    async _screenshotTask(format, options) {
        await this._client.send('Target.activateTarget', {
            targetId: this._target._targetId,
        });
        let clip = options.clip ? processClip(options.clip) : undefined;
        let { captureBeyondViewport = true } = options;
        captureBeyondViewport =
            typeof captureBeyondViewport === 'boolean' ? captureBeyondViewport : true;
        if (options.fullPage) {
            const metrics = await this._client.send('Page.getLayoutMetrics');
            // Fallback to `contentSize` in case of using Firefox.
            const { width, height } = metrics.cssContentSize || metrics.contentSize;
            // Overwrite clip for full page.
            clip = { x: 0, y: 0, width, height, scale: 1 };
            if (!captureBeyondViewport) {
                const { isMobile = false, deviceScaleFactor = 1, isLandscape = false, } = this._viewport || {};
                const screenOrientation = isLandscape
                    ? { angle: 90, type: 'landscapePrimary' }
                    : { angle: 0, type: 'portraitPrimary' };
                await this._client.send('Emulation.setDeviceMetricsOverride', {
                    mobile: isMobile,
                    width,
                    height,
                    deviceScaleFactor,
                    screenOrientation,
                });
            }
        }
        const shouldSetDefaultBackground = options.omitBackground && (format === 'png' || format === 'webp');
        if (shouldSetDefaultBackground) {
            await this._setTransparentBackgroundColor();
        }
        const result = await this._client.send('Page.captureScreenshot', {
            format,
            quality: options.quality,
            clip,
            captureBeyondViewport,
        });
        if (shouldSetDefaultBackground) {
            await this._resetDefaultBackgroundColor();
        }
        if (options.fullPage && this._viewport)
            await this.setViewport(this._viewport);
        const buffer = options.encoding === 'base64'
            ? result.data
            : Buffer.from(result.data, 'base64');
        if (options.path) {
            if (!isNode) {
                throw new Error('Screenshots can only be written to a file path in a Node environment.');
            }
            const fs = await helper.importFSModule();
            await fs.promises.writeFile(options.path, buffer);
        }
        return buffer;
        function processClip(clip) {
            const x = Math.round(clip.x);
            const y = Math.round(clip.y);
            const width = Math.round(clip.width + clip.x - x);
            const height = Math.round(clip.height + clip.y - y);
            return { x, y, width, height, scale: 1 };
        }
    }
    /**
     * Generatees a PDF of the page with the `print` CSS media type.
     * @remarks
     *
     * NOTE: PDF generation is only supported in Chrome headless mode.
     *
     * To generate a PDF with the `screen` media type, call
     * {@link Page.emulateMediaType | `page.emulateMediaType('screen')`} before
     * calling `page.pdf()`.
     *
     * By default, `page.pdf()` generates a pdf with modified colors for printing.
     * Use the
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/-webkit-print-color-adjust | `-webkit-print-color-adjust`}
     * property to force rendering of exact colors.
     *
     *
     * @param options - options for generating the PDF.
     */
    async createPDFStream(options = {}) {
        const { scale = 1, displayHeaderFooter = false, headerTemplate = '', footerTemplate = '', printBackground = false, landscape = false, pageRanges = '', preferCSSPageSize = false, margin = {}, omitBackground = false, timeout = 30000, } = options;
        let paperWidth = 8.5;
        let paperHeight = 11;
        if (options.format) {
            const format = paperFormats[options.format.toLowerCase()];
            assert(format, 'Unknown paper format: ' + options.format);
            paperWidth = format.width;
            paperHeight = format.height;
        }
        else {
            paperWidth = convertPrintParameterToInches(options.width) || paperWidth;
            paperHeight =
                convertPrintParameterToInches(options.height) || paperHeight;
        }
        const marginTop = convertPrintParameterToInches(margin.top) || 0;
        const marginLeft = convertPrintParameterToInches(margin.left) || 0;
        const marginBottom = convertPrintParameterToInches(margin.bottom) || 0;
        const marginRight = convertPrintParameterToInches(margin.right) || 0;
        if (omitBackground) {
            await this._setTransparentBackgroundColor();
        }
        const printCommandPromise = this._client.send('Page.printToPDF', {
            transferMode: 'ReturnAsStream',
            landscape,
            displayHeaderFooter,
            headerTemplate,
            footerTemplate,
            printBackground,
            scale,
            paperWidth,
            paperHeight,
            marginTop,
            marginBottom,
            marginLeft,
            marginRight,
            pageRanges,
            preferCSSPageSize,
        });
        const result = await helper.waitWithTimeout(printCommandPromise, 'Page.printToPDF', timeout);
        if (omitBackground) {
            await this._resetDefaultBackgroundColor();
        }
        return helper.getReadableFromProtocolStream(this._client, result.stream);
    }
    /**
     * @param options -
     * @returns
     */
    async pdf(options = {}) {
        const { path = undefined } = options;
        const readable = await this.createPDFStream(options);
        return await helper.getReadableAsBuffer(readable, path);
    }
    /**
     * @returns The page's title
     * @remarks
     * Shortcut for {@link Frame.title | page.mainFrame().title()}.
     */
    async title() {
        return this.mainFrame().title();
    }
    async close(options = { runBeforeUnload: undefined }) {
        assert(!!this._client._connection, 'Protocol error: Connection closed. Most likely the page has been closed.');
        const runBeforeUnload = !!options.runBeforeUnload;
        if (runBeforeUnload) {
            await this._client.send('Page.close');
        }
        else {
            await this._client._connection.send('Target.closeTarget', {
                targetId: this._target._targetId,
            });
            await this._target._isClosedPromise;
        }
    }
    /**
     * Indicates that the page has been closed.
     * @returns
     */
    isClosed() {
        return this._closed;
    }
    get mouse() {
        return this._mouse;
    }
    /**
     * This method fetches an element with `selector`, scrolls it into view if
     * needed, and then uses {@link Page.mouse} to click in the center of the
     * element. If there's no element matching `selector`, the method throws an
     * error.
     * @remarks Bear in mind that if `click()` triggers a navigation event and
     * there's a separate `page.waitForNavigation()` promise to be resolved, you
     * may end up with a race condition that yields unexpected results. The
     * correct pattern for click and wait for navigation is the following:
     * ```js
     * const [response] = await Promise.all([
     * page.waitForNavigation(waitOptions),
     * page.click(selector, clickOptions),
     * ]);
     * ```
     * Shortcut for {@link Frame.click | page.mainFrame().click(selector[, options]) }.
     * @param selector - A `selector` to search for element to click. If there are
     * multiple elements satisfying the `selector`, the first will be clicked
     * @param options - `Object`
     * @returns Promise which resolves when the element matching `selector` is
     * successfully clicked. The Promise will be rejected if there is no element
     * matching `selector`.
     */
    click(selector, options = {}) {
        return this.mainFrame().click(selector, options);
    }
    /**
     * This method fetches an element with `selector` and focuses it. If there's no
     * element matching `selector`, the method throws an error.
     * @param selector - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector }
     * of an element to focus. If there are multiple elements satisfying the
     * selector, the first will be focused.
     * @returns  Promise which resolves when the element matching selector is
     * successfully focused. The promise will be rejected if there is no element
     * matching selector.
     * @remarks
     * Shortcut for {@link Frame.focus | page.mainFrame().focus(selector)}.
     */
    focus(selector) {
        return this.mainFrame().focus(selector);
    }
    /**
     * This method fetches an element with `selector`, scrolls it into view if
     * needed, and then uses {@link Page.mouse} to hover over the center of the element.
     * If there's no element matching `selector`, the method throws an error.
     * @param selector - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector}
     * to search for element to hover. If there are multiple elements satisfying
     * the selector, the first will be hovered.
     * @returns Promise which resolves when the element matching `selector` is
     * successfully hovered. Promise gets rejected if there's no element matching
     * `selector`.
     * @remarks
     * Shortcut for {@link Page.hover | page.mainFrame().hover(selector)}.
     */
    hover(selector) {
        return this.mainFrame().hover(selector);
    }
    /**
     * Triggers a `change` and `input` event once all the provided options have been
     * selected. If there's no `<select>` element matching `selector`, the method
     * throws an error.
     *
     * @example
     * ```js
     * page.select('select#colors', 'blue'); // single selection
     * page.select('select#colors', 'red', 'green', 'blue'); // multiple selections
     * ```
     * @param selector - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | Selector}
     * to query the page for
     * @param values - Values of options to select. If the `<select>` has the
     * `multiple` attribute, all values are considered, otherwise only the first one
     * is taken into account.
     * @returns
     *
     * @remarks
     * Shortcut for {@link Frame.select | page.mainFrame().select()}
     */
    select(selector, ...values) {
        return this.mainFrame().select(selector, ...values);
    }
    /**
     * This method fetches an element with `selector`, scrolls it into view if
     * needed, and then uses {@link Page.touchscreen} to tap in the center of the element.
     * If there's no element matching `selector`, the method throws an error.
     * @param selector - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | Selector}
     * to search for element to tap. If there are multiple elements satisfying the
     * selector, the first will be tapped.
     * @returns
     * @remarks
     * Shortcut for {@link Frame.tap | page.mainFrame().tap(selector)}.
     */
    tap(selector) {
        return this.mainFrame().tap(selector);
    }
    /**
     * Sends a `keydown`, `keypress/input`, and `keyup` event for each character
     * in the text.
     *
     * To press a special key, like `Control` or `ArrowDown`, use {@link Keyboard.press}.
     * @example
     * ```
     * await page.type('#mytextarea', 'Hello');
     * // Types instantly
     * await page.type('#mytextarea', 'World', { delay: 100 });
     * // Types slower, like a user
     * ```
     * @param selector - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector}
     * of an element to type into. If there are multiple elements satisfying the
     * selector, the first will be used.
     * @param text - A text to type into a focused element.
     * @param options - have property `delay` which is the Time to wait between
     * key presses in milliseconds. Defaults to `0`.
     * @returns
     * @remarks
     */
    type(selector, text, options) {
        return this.mainFrame().type(selector, text, options);
    }
    /**
     * @remarks
     *
     * This method behaves differently depending on the first parameter. If it's a
     * `string`, it will be treated as a `selector` or `xpath` (if the string
     * starts with `//`). This method then is a shortcut for
     * {@link Page.waitForSelector} or {@link Page.waitForXPath}.
     *
     * If the first argument is a function this method is a shortcut for
     * {@link Page.waitForFunction}.
     *
     * If the first argument is a `number`, it's treated as a timeout in
     * milliseconds and the method returns a promise which resolves after the
     * timeout.
     *
     * @param selectorOrFunctionOrTimeout - a selector, predicate or timeout to
     * wait for.
     * @param options - optional waiting parameters.
     * @param args - arguments to pass to `pageFunction`.
     *
     * @deprecated Don't use this method directly. Instead use the more explicit
     * methods available: {@link Page.waitForSelector},
     * {@link Page.waitForXPath}, {@link Page.waitForFunction} or
     * {@link Page.waitForTimeout}.
     */
    waitFor(selectorOrFunctionOrTimeout, options = {}, ...args) {
        return this.mainFrame().waitFor(selectorOrFunctionOrTimeout, options, ...args);
    }
    /**
     * Causes your script to wait for the given number of milliseconds.
     *
     * @remarks
     *
     * It's generally recommended to not wait for a number of seconds, but instead
     * use {@link Page.waitForSelector}, {@link Page.waitForXPath} or
     * {@link Page.waitForFunction} to wait for exactly the conditions you want.
     *
     * @example
     *
     * Wait for 1 second:
     *
     * ```
     * await page.waitForTimeout(1000);
     * ```
     *
     * @param milliseconds - the number of milliseconds to wait.
     */
    waitForTimeout(milliseconds) {
        return this.mainFrame().waitForTimeout(milliseconds);
    }
    /**
     * Wait for the `selector` to appear in page. If at the moment of calling the
     * method the `selector` already exists, the method will return immediately. If
     * the `selector` doesn't appear after the `timeout` milliseconds of waiting, the
     * function will throw.
     *
     * This method works across navigations:
     * ```js
     * const puppeteer = require('puppeteer');
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * let currentURL;
     * page
     * .waitForSelector('img')
     * .then(() => console.log('First URL with image: ' + currentURL));
     * for (currentURL of [
     * 'https://example.com',
     * 'https://google.com',
     * 'https://bbc.com',
     * ]) {
     * await page.goto(currentURL);
     * }
     * await browser.close();
     * })();
     * ```
     * @param selector - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_Selectors | selector}
     * of an element to wait for
     * @param options - Optional waiting parameters
     * @returns Promise which resolves when element specified by selector string
     * is added to DOM. Resolves to `null` if waiting for hidden: `true` and
     * selector is not found in DOM.
     * @remarks
     * The optional Parameter in Arguments `options` are :
     *
     * - `Visible`: A boolean wait for element to be present in DOM and to be
     * visible, i.e. to not have `display: none` or `visibility: hidden` CSS
     * properties. Defaults to `false`.
     *
     * - `hidden`: ait for element to not be found in the DOM or to be hidden,
     * i.e. have `display: none` or `visibility: hidden` CSS properties. Defaults to
     * `false`.
     *
     * - `timeout`: maximum time to wait for in milliseconds. Defaults to `30000`
     * (30 seconds). Pass `0` to disable timeout. The default value can be changed
     * by using the {@link Page.setDefaultTimeout} method.
     */
    waitForSelector(selector, options = {}) {
        return this.mainFrame().waitForSelector(selector, options);
    }
    /**
     * Wait for the `xpath` to appear in page. If at the moment of calling the
     * method the `xpath` already exists, the method will return immediately. If
     * the `xpath` doesn't appear after the `timeout` milliseconds of waiting, the
     * function will throw.
     *
     * This method works across navigation
     * ```js
     * const puppeteer = require('puppeteer');
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * let currentURL;
     * page
     * .waitForXPath('//img')
     * .then(() => console.log('First URL with image: ' + currentURL));
     * for (currentURL of [
     * 'https://example.com',
     * 'https://google.com',
     * 'https://bbc.com',
     * ]) {
     * await page.goto(currentURL);
     * }
     * await browser.close();
     * })();
     * ```
     * @param xpath - A
     * {@link https://developer.mozilla.org/en-US/docs/Web/XPath | xpath} of an
     * element to wait for
     * @param options - Optional waiting parameters
     * @returns Promise which resolves when element specified by xpath string is
     * added to DOM. Resolves to `null` if waiting for `hidden: true` and xpath is
     * not found in DOM.
     * @remarks
     * The optional Argument `options` have properties:
     *
     * - `visible`: A boolean to wait for element to be present in DOM and to be
     * visible, i.e. to not have `display: none` or `visibility: hidden` CSS
     * properties. Defaults to `false`.
     *
     * - `hidden`: A boolean wait for element to not be found in the DOM or to be
     * hidden, i.e. have `display: none` or `visibility: hidden` CSS properties.
     * Defaults to `false`.
     *
     * - `timeout`: A number which is maximum time to wait for in milliseconds.
     * Defaults to `30000` (30 seconds). Pass `0` to disable timeout. The default
     * value can be changed by using the {@link Page.setDefaultTimeout} method.
     */
    waitForXPath(xpath, options = {}) {
        return this.mainFrame().waitForXPath(xpath, options);
    }
    /**
     * The `waitForFunction` can be used to observe viewport size change:
     *
     * ```
     * const puppeteer = require('puppeteer');
     * (async () => {
     * const browser = await puppeteer.launch();
     * const page = await browser.newPage();
     * const watchDog = page.waitForFunction('window.innerWidth < 100');
     * await page.setViewport({ width: 50, height: 50 });
     * await watchDog;
     * await browser.close();
     * })();
     * ```
     * To pass arguments from node.js to the predicate of `page.waitForFunction` function:
     * ```
     * const selector = '.foo';
     * await page.waitForFunction(
     * (selector) => !!document.querySelector(selector),
     * {},
     * selector
     * );
     * ```
     * The predicate of `page.waitForFunction` can be asynchronous too:
     * ```
     * const username = 'github-username';
     * await page.waitForFunction(
     * async (username) => {
     * const githubResponse = await fetch(
     *  `https://api.github.com/users/${username}`
     * );
     * const githubUser = await githubResponse.json();
     * // show the avatar
     * const img = document.createElement('img');
     * img.src = githubUser.avatar_url;
     * // wait 3 seconds
     * await new Promise((resolve, reject) => setTimeout(resolve, 3000));
     * img.remove();
     * },
     * {},
     * username
     * );
     * ```
     * @param pageFunction - Function to be evaluated in browser context
     * @param options - Optional waiting parameters
     * @param args -  Arguments to pass to `pageFunction`
     * @returns Promise which resolves when the `pageFunction` returns a truthy
     * value. It resolves to a JSHandle of the truthy value.
     *
     * The optional waiting parameter can be:
     *
     * - `Polling`: An interval at which the `pageFunction` is executed, defaults to
     *   `raf`. If `polling` is a number, then it is treated as an interval in
     *   milliseconds at which the function would be executed. If polling is a
     *   string, then it can be one of the following values:<br/>
     *    - `raf`: to constantly execute `pageFunction` in `requestAnimationFrame`
     *      callback. This is the tightest polling mode which is suitable to
     *      observe styling changes.<br/>
     *    - `mutation`: to execute pageFunction on every DOM mutation.
     *
     * - `timeout`: maximum time to wait for in milliseconds. Defaults to `30000`
     * (30 seconds). Pass `0` to disable timeout. The default value can be changed
     * by using the
     * {@link Page.setDefaultTimeout | page.setDefaultTimeout(timeout)} method.
     *
     */
    waitForFunction(pageFunction, options = {}, ...args) {
        return this.mainFrame().waitForFunction(pageFunction, options, ...args);
    }
}
const supportedMetrics = new Set([
    'Timestamp',
    'Documents',
    'Frames',
    'JSEventListeners',
    'Nodes',
    'LayoutCount',
    'RecalcStyleCount',
    'LayoutDuration',
    'RecalcStyleDuration',
    'ScriptDuration',
    'TaskDuration',
    'JSHeapUsedSize',
    'JSHeapTotalSize',
]);
const unitToPixels = {
    px: 1,
    in: 96,
    cm: 37.8,
    mm: 3.78,
};
function convertPrintParameterToInches(parameter) {
    if (typeof parameter === 'undefined')
        return undefined;
    let pixels;
    if (helper.isNumber(parameter)) {
        // Treat numbers as pixel values to be aligned with phantom's paperSize.
        pixels = /** @type {number} */ parameter;
    }
    else if (helper.isString(parameter)) {
        const text = /** @type {string} */ parameter;
        let unit = text.substring(text.length - 2).toLowerCase();
        let valueText = '';
        if (unitToPixels.hasOwnProperty(unit)) {
            valueText = text.substring(0, text.length - 2);
        }
        else {
            // In case of unknown unit try to parse the whole parameter as number of pixels.
            // This is consistent with phantom's paperSize behavior.
            unit = 'px';
            valueText = text;
        }
        const value = Number(valueText);
        assert(!isNaN(value), 'Failed to parse parameter value: ' + text);
        pixels = value * unitToPixels[unit];
    }
    else {
        throw new Error('page.pdf() Cannot handle parameter type: ' + typeof parameter);
    }
    return pixels / 96;
}
//# sourceMappingURL=Page.js.map

Creat By MiNi SheLL
Email: jattceo@gmail.com